C26H25Cl2N3O6S3 — CID 174439648
5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-[4-[1-(1-oxo-1,4-thiazinan-4-yl)prop-2-enylsulfonyl]phenyl]benzamide (PubChem CID 174439648) has the molecular formula C26H25Cl2N3O6S3 and a molecular weight of 642.61 g/mol. Its IUPAC name is 5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-[4-[1-(1-oxo-1,4-thiazinan-4-yl)prop-2-enylsulfonyl]phenyl]benzamide.
| Compound Name | 5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-[4-[1-(1-oxo-1,4-thiazinan-4-yl)prop-2-enylsulfonyl]phenyl]benzamide |
|---|---|
| PubChem CID | 174439648 |
| Molecular Formula | C26H25Cl2N3O6S3 |
| Molecular Weight | 642.61 g/mol |
| Exact Mass | 641.03 |
| IUPAC Name | 5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-[4-[1-(1-oxo-1,4-thiazinan-4-yl)prop-2-enylsulfonyl]phenyl]benzamide |
| SMILES | C=CC(N1CCS(=O)CC1)S(=O)(=O)c1ccc(NC(=O)c2cc(Cl)ccc2NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H25Cl2N3O6S3/c1-2-25(31-13-15-38(33)16-14-31)39(34,35)21-10-6-20(7-11-21)29-26(32)23-17-19(28)5-12-24(23)30-40(36,37)22-8-3-18(27)4-9-22/h2-12,17,25,30H,1,13-16H2,(H,29,32) |
| InChIKey | KBMZDUVLTMNXTE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|