C18H29N2O4S- — CID 174441029
1-(5-aminopentyl)-4-[2-carboxy-2-(sulfinatoamino)hexyl]benzene (PubChem CID 174441029) has the molecular formula C18H29N2O4S- and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-(5-aminopentyl)-4-[2-carboxy-2-(sulfinatoamino)hexyl]benzene.
| Compound Name | 1-(5-aminopentyl)-4-[2-carboxy-2-(sulfinatoamino)hexyl]benzene |
|---|---|
| PubChem CID | 174441029 |
| Molecular Formula | C18H29N2O4S- |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 1-(5-aminopentyl)-4-[2-carboxy-2-(sulfinatoamino)hexyl]benzene |
| SMILES | CCCCC(Cc1ccc(CCCCCN)cc1)(NS(=O)[O-])C(=O)O |
| InChI | InChI=1S/C18H30N2O4S/c1-2-3-12-18(17(21)22,20-25(23)24)14-16-10-8-15(9-11-16)7-5-4-6-13-19/h8-11,20H,2-7,12-14,19H2,1H3,(H,21,22)(H,23,24)/p-1 |
| InChIKey | NAWCMLUFCKWAIU-UHFFFAOYSA-M |
| XLogP | 2.30 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|