About 2-chloropyrimidin-4-amine;1-fluoro-4-methylbenzene
2-chloropyrimidin-4-amine;1-fluoro-4-methylbenzene (PubChem CID 174441356) has the molecular formula C11H11ClFN3
and a molecular weight of 239.68 g/mol. Its IUPAC name is 2-chloropyrimidin-4-amine;1-fluoro-4-methylbenzene.
Molecular Properties
| Compound Name | 2-chloropyrimidin-4-amine;1-fluoro-4-methylbenzene |
| PubChem CID | 174441356 |
| Molecular Formula | C11H11ClFN3 |
| Molecular Weight | 239.68 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-chloropyrimidin-4-amine;1-fluoro-4-methylbenzene |
| SMILES | Cc1ccc(F)cc1.Nc1ccnc(Cl)n1 |
| InChI | InChI=1S/C7H7F.C4H4ClN3/c1-6-2-4-7(8)5-3-6;5-4-7-2-1-3(6)8-4/h2-5H,1H3;1-2H,(H2,6,7,8) |
| InChIKey | OUVFPTOAUDAGQD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.68 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloropyrimidin-4-amine;1-fluoro-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropyrimidin-4-amine;1-fluoro-4-methylbenzene?
The IUPAC name of 2-chloropyrimidin-4-amine;1-fluoro-4-methylbenzene (CID 174441356) is 2-chloropyrimidin-4-amine;1-fluoro-4-methylbenzene.
What is the SMILES notation for 2-chloropyrimidin-4-amine;1-fluoro-4-methylbenzene?
The canonical SMILES for 2-chloropyrimidin-4-amine;1-fluoro-4-methylbenzene is Cc1ccc(F)cc1.Nc1ccnc(Cl)n1.
What is the InChIKey of 2-chloropyrimidin-4-amine;1-fluoro-4-methylbenzene?
The InChIKey is OUVFPTOAUDAGQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F.C4H4ClN3/c1-6-2-4-7(8)5-3-6;5-4-7-2-1-3(6)8-4/h2-5H,1H3;1-2H,(H2,6,7,8).
What are the key properties of 2-chloropyrimidin-4-amine;1-fluoro-4-methylbenzene?
2-chloropyrimidin-4-amine;1-fluoro-4-methylbenzene has a molecular weight of 239.68 g/mol, XLogP of 2.85, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropyrimidin-4-amine;1-fluoro-4-methylbenzene is sourced from PubChem (CID 174441356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).