C12H20N4S — CID 174441540
ethyl N'-[4-(2-aminoethyl)-2-(aminomethyl)phenyl]carbamimidothioate (PubChem CID 174441540) has the molecular formula C12H20N4S and a molecular weight of 252.39 g/mol. Its IUPAC name is ethyl N'-[4-(2-aminoethyl)-2-(aminomethyl)phenyl]carbamimidothioate.
| Compound Name | ethyl N'-[4-(2-aminoethyl)-2-(aminomethyl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 174441540 |
| Molecular Formula | C12H20N4S |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | ethyl N'-[4-(2-aminoethyl)-2-(aminomethyl)phenyl]carbamimidothioate |
| SMILES | CCS/C(N)=N\c1ccc(CCN)cc1CN |
| InChI | InChI=1S/C12H20N4S/c1-2-17-12(15)16-11-4-3-9(5-6-13)7-10(11)8-14/h3-4,7H,2,5-6,8,13-14H2,1H3,(H2,15,16) |
| InChIKey | NQHXPYYMLZLAAC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|