C9H14Cl2N6 — CID 174494606
2-[2-(aminomethyl)-4-chlorophenyl]-1-(diaminomethylidene)guanidine;hydrochloride (PubChem CID 174494606) has the molecular formula C9H14Cl2N6 and a molecular weight of 277.16 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-4-chlorophenyl]-1-(diaminomethylidene)guanidine;hydrochloride.
| Compound Name | 2-[2-(aminomethyl)-4-chlorophenyl]-1-(diaminomethylidene)guanidine;hydrochloride |
|---|---|
| PubChem CID | 174494606 |
| Molecular Formula | C9H14Cl2N6 |
| Molecular Weight | 277.16 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-[2-(aminomethyl)-4-chlorophenyl]-1-(diaminomethylidene)guanidine;hydrochloride |
| SMILES | Cl.NCc1cc(Cl)ccc1/N=C(\N)N=C(N)N |
| InChI | InChI=1S/C9H13ClN6.ClH/c10-6-1-2-7(5(3-6)4-11)15-9(14)16-8(12)13;/h1-3H,4,11H2,(H6,12,13,14,15,16);1H |
| InChIKey | OTNTVLTWPIXMOO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.16 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|