About 2-iminoethyl 5-(dimethylamino)hexanoate
2-iminoethyl 5-(dimethylamino)hexanoate (PubChem CID 174445049) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-iminoethyl 5-(dimethylamino)hexanoate.
Molecular Properties
| Compound Name | 2-iminoethyl 5-(dimethylamino)hexanoate |
| PubChem CID | 174445049 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 2-iminoethyl 5-(dimethylamino)hexanoate |
| SMILES | [H]/N=C/COC(=O)CCCC(C)N(C)C |
| InChI | InChI=1S/C10H20N2O2/c1-9(12(2)3)5-4-6-10(13)14-8-7-11/h7,9,11H,4-6,8H2,1-3H3/b11-7+ |
| InChIKey | ZJPDJHGHWPOFPB-YRNVUSSQSA-N |
| XLogP | 1.30 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iminoethyl 5-(dimethylamino)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminoethyl 5-(dimethylamino)hexanoate?
The IUPAC name of 2-iminoethyl 5-(dimethylamino)hexanoate (CID 174445049) is 2-iminoethyl 5-(dimethylamino)hexanoate.
What is the SMILES notation for 2-iminoethyl 5-(dimethylamino)hexanoate?
The canonical SMILES for 2-iminoethyl 5-(dimethylamino)hexanoate is [H]/N=C/COC(=O)CCCC(C)N(C)C.
What is the InChIKey of 2-iminoethyl 5-(dimethylamino)hexanoate?
The InChIKey is ZJPDJHGHWPOFPB-YRNVUSSQSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-9(12(2)3)5-4-6-10(13)14-8-7-11/h7,9,11H,4-6,8H2,1-3H3/b11-7+.
What are the key properties of 2-iminoethyl 5-(dimethylamino)hexanoate?
2-iminoethyl 5-(dimethylamino)hexanoate has a molecular weight of 200.28 g/mol, XLogP of 1.30, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminoethyl 5-(dimethylamino)hexanoate is sourced from PubChem (CID 174445049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).