C23H24ClN5O3S — CID 174448595
1-[(4-aminoquinazolin-7-yl)methyl]-4-[(1S)-4-(5-chlorothiophen-2-yl)-1-ethoxy-2-oxobut-3-enyl]piperazin-2-one (PubChem CID 174448595) has the molecular formula C23H24ClN5O3S and a molecular weight of 486.00 g/mol. Its IUPAC name is 1-[(4-aminoquinazolin-7-yl)methyl]-4-[(1S)-4-(5-chlorothiophen-2-yl)-1-ethoxy-2-oxobut-3-enyl]piperazin-2-one.
| Compound Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-[(1S)-4-(5-chlorothiophen-2-yl)-1-ethoxy-2-oxobut-3-enyl]piperazin-2-one |
|---|---|
| PubChem CID | 174448595 |
| Molecular Formula | C23H24ClN5O3S |
| Molecular Weight | 486.00 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-[(1S)-4-(5-chlorothiophen-2-yl)-1-ethoxy-2-oxobut-3-enyl]piperazin-2-one |
| SMILES | CCO[C@@H](C(=O)C=Cc1ccc(Cl)s1)N1CCN(Cc2ccc3c(N)ncnc3c2)C(=O)C1 |
| InChI | InChI=1S/C23H24ClN5O3S/c1-2-32-23(19(30)7-4-16-5-8-20(24)33-16)29-10-9-28(21(31)13-29)12-15-3-6-17-18(11-15)26-14-27-22(17)25/h3-8,11,14,23H,2,9-10,12-13H2,1H3,(H2,25,26,27)/t23-/m0/s1 |
| InChIKey | UDMABOJTQUHJHE-QHCPKHFHSA-N |
| XLogP | 3.22 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.00 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|