C24H24ClN5O4 — CID 67014110
1-[(4-aminoquinazolin-7-yl)methyl]-4-[(E,1S)-4-(3-chloro-4-hydroxyphenyl)-1-methoxy-2-oxobut-3-enyl]piperazin-2-one (PubChem CID 67014110) has the molecular formula C24H24ClN5O4 and a molecular weight of 481.94 g/mol. Its IUPAC name is 1-[(4-aminoquinazolin-7-yl)methyl]-4-[(E,1S)-4-(3-chloro-4-hydroxyphenyl)-1-methoxy-2-oxobut-3-enyl]piperazin-2-one.
| Compound Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-[(E,1S)-4-(3-chloro-4-hydroxyphenyl)-1-methoxy-2-oxobut-3-enyl]piperazin-2-one |
|---|---|
| PubChem CID | 67014110 |
| Molecular Formula | C24H24ClN5O4 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-[(E,1S)-4-(3-chloro-4-hydroxyphenyl)-1-methoxy-2-oxobut-3-enyl]piperazin-2-one |
| SMILES | CO[C@@H](C(=O)/C=C/c1ccc(O)c(Cl)c1)N1CCN(Cc2ccc3c(N)ncnc3c2)C(=O)C1 |
| InChI | InChI=1S/C24H24ClN5O4/c1-34-24(21(32)7-4-15-3-6-20(31)18(25)10-15)30-9-8-29(22(33)13-30)12-16-2-5-17-19(11-16)27-14-28-23(17)26/h2-7,10-11,14,24,31H,8-9,12-13H2,1H3,(H2,26,27,28)/b7-4+/t24-/m0/s1 |
| InChIKey | YOVQCDNIXOONPQ-BSBODGDASA-N |
| XLogP | 2.47 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|