About 2-formyl-N'-hydroxybutanediamide
2-formyl-N'-hydroxybutanediamide (PubChem CID 174449335) has the molecular formula C5H8N2O4
and a molecular weight of 160.13 g/mol. Its IUPAC name is 2-formyl-N'-hydroxybutanediamide.
Molecular Properties
| Compound Name | 2-formyl-N'-hydroxybutanediamide |
| PubChem CID | 174449335 |
| Molecular Formula | C5H8N2O4 |
| Molecular Weight | 160.13 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 2-formyl-N'-hydroxybutanediamide |
| SMILES | NC(=O)C(C=O)CC(=O)NO |
| InChI | InChI=1S/C5H8N2O4/c6-5(10)3(2-8)1-4(9)7-11/h2-3,11H,1H2,(H2,6,10)(H,7,9) |
| InChIKey | BHTUQDRDZMYJMO-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.13 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-formyl-N'-hydroxybutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formyl-N'-hydroxybutanediamide?
The IUPAC name of 2-formyl-N'-hydroxybutanediamide (CID 174449335) is 2-formyl-N'-hydroxybutanediamide.
What is the SMILES notation for 2-formyl-N'-hydroxybutanediamide?
The canonical SMILES for 2-formyl-N'-hydroxybutanediamide is NC(=O)C(C=O)CC(=O)NO.
What is the InChIKey of 2-formyl-N'-hydroxybutanediamide?
The InChIKey is BHTUQDRDZMYJMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O4/c6-5(10)3(2-8)1-4(9)7-11/h2-3,11H,1H2,(H2,6,10)(H,7,9).
What are the key properties of 2-formyl-N'-hydroxybutanediamide?
2-formyl-N'-hydroxybutanediamide has a molecular weight of 160.13 g/mol, XLogP of -1.82, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formyl-N'-hydroxybutanediamide is sourced from PubChem (CID 174449335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).