C34H20O8S2 — CID 174450119
dianthracen-1-yl 3,6-dioxocyclohexa-1,4-diene-1,2-disulfonate (PubChem CID 174450119) has the molecular formula C34H20O8S2 and a molecular weight of 620.66 g/mol. Its IUPAC name is dianthracen-1-yl 3,6-dioxocyclohexa-1,4-diene-1,2-disulfonate.
| Compound Name | dianthracen-1-yl 3,6-dioxocyclohexa-1,4-diene-1,2-disulfonate |
|---|---|
| PubChem CID | 174450119 |
| Molecular Formula | C34H20O8S2 |
| Molecular Weight | 620.66 g/mol |
| Exact Mass | 620.06 |
| IUPAC Name | dianthracen-1-yl 3,6-dioxocyclohexa-1,4-diene-1,2-disulfonate |
| SMILES | O=C1C=CC(=O)C(S(=O)(=O)Oc2cccc3cc4ccccc4cc23)=C1S(=O)(=O)Oc1cccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C34H20O8S2/c35-29-15-16-30(36)34(44(39,40)42-32-14-6-12-26-18-22-8-2-4-10-24(22)20-28(26)32)33(29)43(37,38)41-31-13-5-11-25-17-21-7-1-3-9-23(21)19-27(25)31/h1-20H |
| InChIKey | OSFHZLGWMYLGSO-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.66 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|