C10H21N5O3 — CID 174452510
2,4,8-triamino-2-(2-aminoacetyl)-3-oxooctanamide (PubChem CID 174452510) has the molecular formula C10H21N5O3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2,4,8-triamino-2-(2-aminoacetyl)-3-oxooctanamide.
| Compound Name | 2,4,8-triamino-2-(2-aminoacetyl)-3-oxooctanamide |
|---|---|
| PubChem CID | 174452510 |
| Molecular Formula | C10H21N5O3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 2,4,8-triamino-2-(2-aminoacetyl)-3-oxooctanamide |
| SMILES | NCCCCC(N)C(=O)C(N)(C(N)=O)C(=O)CN |
| InChI | InChI=1S/C10H21N5O3/c11-4-2-1-3-6(13)8(17)10(15,9(14)18)7(16)5-12/h6H,1-5,11-13,15H2,(H2,14,18) |
| InChIKey | VYTLJQAVQXOGEC-UHFFFAOYSA-N |
| XLogP | -3.28 |
| TPSA | 181.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|