C10H7Cl2N3 — CID 174452686
2-(chloromethyl)-4-(2-chlorophenyl)-1,3,5-triazine (PubChem CID 174452686) has the molecular formula C10H7Cl2N3 and a molecular weight of 240.09 g/mol. Its IUPAC name is 2-(chloromethyl)-4-(2-chlorophenyl)-1,3,5-triazine.
| Compound Name | 2-(chloromethyl)-4-(2-chlorophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 174452686 |
| Molecular Formula | C10H7Cl2N3 |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 239.00 |
| IUPAC Name | 2-(chloromethyl)-4-(2-chlorophenyl)-1,3,5-triazine |
| SMILES | ClCc1ncnc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C10H7Cl2N3/c11-5-9-13-6-14-10(15-9)7-3-1-2-4-8(7)12/h1-4,6H,5H2 |
| InChIKey | PIDWEGYKYXVFQR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|