C13H9Cl9N4 — CID 126707772
1-chloro-N-(chloromethyl)methanamine;2-(2-chlorophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 126707772) has the molecular formula C13H9Cl9N4 and a molecular weight of 540.32 g/mol. Its IUPAC name is 1-chloro-N-(chloromethyl)methanamine;2-(2-chlorophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 1-chloro-N-(chloromethyl)methanamine;2-(2-chlorophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 126707772 |
| Molecular Formula | C13H9Cl9N4 |
| Molecular Weight | 540.32 g/mol |
| Exact Mass | 535.80 |
| IUPAC Name | 1-chloro-N-(chloromethyl)methanamine;2-(2-chlorophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | ClCNCCl.Clc1ccccc1-c1nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C11H4Cl7N3.C2H5Cl2N/c12-6-4-2-1-3-5(6)7-19-8(10(13,14)15)21-9(20-7)11(16,17)18;3-1-5-2-4/h1-4H;5H,1-2H2 |
| InChIKey | NXNIPOIXBXWZIN-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.32 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|