C11H3Cl8N3 — CID 22146364
2-(2,6-dichlorophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 22146364) has the molecular formula C11H3Cl8N3 and a molecular weight of 460.79 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-(2,6-dichlorophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 22146364 |
| Molecular Formula | C11H3Cl8N3 |
| Molecular Weight | 460.79 g/mol |
| Exact Mass | 456.78 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | Clc1cccc(Cl)c1-c1nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C11H3Cl8N3/c12-4-2-1-3-5(13)6(4)7-20-8(10(14,15)16)22-9(21-7)11(17,18)19/h1-3H |
| InChIKey | MNCNHQQFMSMDLP-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.79 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|