C15H24O6Sn — CID 174453011
(Z)-but-2-enedioate;octyltin(3+);propanoate (PubChem CID 174453011) has the molecular formula C15H24O6Sn and a molecular weight of 419.06 g/mol. Its IUPAC name is (Z)-but-2-enedioate;octyltin(3+);propanoate.
| Compound Name | (Z)-but-2-enedioate;octyltin(3+);propanoate |
|---|---|
| PubChem CID | 174453011 |
| Molecular Formula | C15H24O6Sn |
| Molecular Weight | 419.06 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | (Z)-but-2-enedioate;octyltin(3+);propanoate |
| SMILES | CCC(=O)[O-].CCCCCCCC[Sn+3].O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/C8H17.C4H4O4.C3H6O2.Sn/c1-3-5-7-8-6-4-2;5-3(6)1-2-4(7)8;1-2-3(4)5;/h1,3-8H2,2H3;1-2H,(H,5,6)(H,7,8);2H2,1H3,(H,4,5);/q;;;+3/p-3/b;2-1-;; |
| InChIKey | OXRLROJTJZOLCM-IUJXYRIYSA-K |
| XLogP | -0.88 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.06 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|