About 1-(2-bromophenyl)-1-phenylurea;3-phenylphenol
1-(2-bromophenyl)-1-phenylurea;3-phenylphenol (PubChem CID 174458019) has the molecular formula C25H21BrN2O2
and a molecular weight of 461.36 g/mol. Its IUPAC name is 1-(2-bromophenyl)-1-phenylurea;3-phenylphenol.
Molecular Properties
| Compound Name | 1-(2-bromophenyl)-1-phenylurea;3-phenylphenol |
| PubChem CID | 174458019 |
| Molecular Formula | C25H21BrN2O2 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 1-(2-bromophenyl)-1-phenylurea;3-phenylphenol |
| SMILES | NC(=O)N(c1ccccc1)c1ccccc1Br.Oc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C13H11BrN2O.C12H10O/c14-11-8-4-5-9-12(11)16(13(15)17)10-6-2-1-3-7-10;13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H,(H2,15,17);1-9,13H |
| InChIKey | QBSMZFNIVUFMSO-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-bromophenyl)-1-phenylurea;3-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromophenyl)-1-phenylurea;3-phenylphenol?
The IUPAC name of 1-(2-bromophenyl)-1-phenylurea;3-phenylphenol (CID 174458019) is 1-(2-bromophenyl)-1-phenylurea;3-phenylphenol.
What is the SMILES notation for 1-(2-bromophenyl)-1-phenylurea;3-phenylphenol?
The canonical SMILES for 1-(2-bromophenyl)-1-phenylurea;3-phenylphenol is NC(=O)N(c1ccccc1)c1ccccc1Br.Oc1cccc(-c2ccccc2)c1.
What is the InChIKey of 1-(2-bromophenyl)-1-phenylurea;3-phenylphenol?
The InChIKey is QBSMZFNIVUFMSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrN2O.C12H10O/c14-11-8-4-5-9-12(11)16(13(15)17)10-6-2-1-3-7-10;13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H,(H2,15,17);1-9,13H.
What are the key properties of 1-(2-bromophenyl)-1-phenylurea;3-phenylphenol?
1-(2-bromophenyl)-1-phenylurea;3-phenylphenol has a molecular weight of 461.36 g/mol, XLogP of 6.73, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromophenyl)-1-phenylurea;3-phenylphenol is sourced from PubChem (CID 174458019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).