C14H12N2O2 — CID 91260072
N-carbamoyl-N-(3-phenylphenyl)formamide (PubChem CID 91260072) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is N-carbamoyl-N-(3-phenylphenyl)formamide.
| Compound Name | N-carbamoyl-N-(3-phenylphenyl)formamide |
|---|---|
| PubChem CID | 91260072 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-carbamoyl-N-(3-phenylphenyl)formamide |
| SMILES | NC(=O)N(C=O)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C14H12N2O2/c15-14(18)16(10-17)13-8-4-7-12(9-13)11-5-2-1-3-6-11/h1-10H,(H2,15,18) |
| InChIKey | ZXYFXQVJSPJIFK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|