C11H9N3O2S — CID 91604276
N-carbamoyl-N-[3-(1,3-thiazol-2-yl)phenyl]formamide (PubChem CID 91604276) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is N-carbamoyl-N-[3-(1,3-thiazol-2-yl)phenyl]formamide.
| Compound Name | N-carbamoyl-N-[3-(1,3-thiazol-2-yl)phenyl]formamide |
|---|---|
| PubChem CID | 91604276 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | N-carbamoyl-N-[3-(1,3-thiazol-2-yl)phenyl]formamide |
| SMILES | NC(=O)N(C=O)c1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C11H9N3O2S/c12-11(16)14(7-15)9-3-1-2-8(6-9)10-13-4-5-17-10/h1-7H,(H2,12,16) |
| InChIKey | HHMXTDOIIHYMPY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|