C23H24N3O2S- — CID 174459073
4-[4-(3-carbamimidoylphenyl)butyl]-1-phenyl-2-(sulfinatoamino)benzene (PubChem CID 174459073) has the molecular formula C23H24N3O2S- and a molecular weight of 406.53 g/mol. Its IUPAC name is 4-[4-(3-carbamimidoylphenyl)butyl]-1-phenyl-2-(sulfinatoamino)benzene.
| Compound Name | 4-[4-(3-carbamimidoylphenyl)butyl]-1-phenyl-2-(sulfinatoamino)benzene |
|---|---|
| PubChem CID | 174459073 |
| Molecular Formula | C23H24N3O2S- |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 4-[4-(3-carbamimidoylphenyl)butyl]-1-phenyl-2-(sulfinatoamino)benzene |
| SMILES | [H]/N=C(\N)c1cccc(CCCCc2ccc(-c3ccccc3)c(NS(=O)[O-])c2)c1 |
| InChI | InChI=1S/C23H25N3O2S/c24-23(25)20-12-6-9-17(15-20)7-4-5-8-18-13-14-21(19-10-2-1-3-11-19)22(16-18)26-29(27)28/h1-3,6,9-16,26H,4-5,7-8H2,(H3,24,25)(H,27,28)/p-1 |
| InChIKey | GHUOKJZZDDUCCC-UHFFFAOYSA-M |
| XLogP | 4.41 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|