C32H32N2O7S — CID 174459132
2-(benzenesulfonamido)-3-[4-[4-imino-5-oxo-6-[4-(phenoxymethyl)phenyl]hexan-3-yl]furan-2-yl]propanoic acid (PubChem CID 174459132) has the molecular formula C32H32N2O7S and a molecular weight of 588.68 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-3-[4-[4-imino-5-oxo-6-[4-(phenoxymethyl)phenyl]hexan-3-yl]furan-2-yl]propanoic acid.
| Compound Name | 2-(benzenesulfonamido)-3-[4-[4-imino-5-oxo-6-[4-(phenoxymethyl)phenyl]hexan-3-yl]furan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 174459132 |
| Molecular Formula | C32H32N2O7S |
| Molecular Weight | 588.68 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | 2-(benzenesulfonamido)-3-[4-[4-imino-5-oxo-6-[4-(phenoxymethyl)phenyl]hexan-3-yl]furan-2-yl]propanoic acid |
| SMILES | [H]/N=C(\C(=O)Cc1ccc(COc2ccccc2)cc1)C(CC)c1coc(CC(NS(=O)(=O)c2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C32H32N2O7S/c1-2-28(31(33)30(35)17-22-13-15-23(16-14-22)20-40-25-9-5-3-6-10-25)24-18-26(41-21-24)19-29(32(36)37)34-42(38,39)27-11-7-4-8-12-27/h3-16,18,21,28-29,33-34H,2,17,19-20H2,1H3,(H,36,37)/b33-31- |
| InChIKey | XMHGUUVAPHQAII-FPODKLOTSA-N |
| XLogP | 5.16 |
| TPSA | 146.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.68 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|