C13H12N2O5 — CID 174462631
[1-nitro-2-(2-nitrophenyl)cyclohexa-2,4-dien-1-yl]methanol (PubChem CID 174462631) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is [1-nitro-2-(2-nitrophenyl)cyclohexa-2,4-dien-1-yl]methanol.
| Compound Name | [1-nitro-2-(2-nitrophenyl)cyclohexa-2,4-dien-1-yl]methanol |
|---|---|
| PubChem CID | 174462631 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | [1-nitro-2-(2-nitrophenyl)cyclohexa-2,4-dien-1-yl]methanol |
| SMILES | O=[N+]([O-])c1ccccc1C1=CC=CCC1(CO)[N+](=O)[O-] |
| InChI | InChI=1S/C13H12N2O5/c16-9-13(15(19)20)8-4-3-6-11(13)10-5-1-2-7-12(10)14(17)18/h1-7,16H,8-9H2 |
| InChIKey | VYDNOOOGPIGBRJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|