C13H13NO7 — CID 16728349
(1R,4R,5R)-1,4,5-trihydroxy-3-(2-nitrophenyl)cyclohex-2-ene-1-carboxylic acid (PubChem CID 16728349) has the molecular formula C13H13NO7 and a molecular weight of 295.25 g/mol. Its IUPAC name is (1R,4R,5R)-1,4,5-trihydroxy-3-(2-nitrophenyl)cyclohex-2-ene-1-carboxylic acid.
| Compound Name | (1R,4R,5R)-1,4,5-trihydroxy-3-(2-nitrophenyl)cyclohex-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 16728349 |
| Molecular Formula | C13H13NO7 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | (1R,4R,5R)-1,4,5-trihydroxy-3-(2-nitrophenyl)cyclohex-2-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@]1(O)C=C(c2ccccc2[N+](=O)[O-])[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C13H13NO7/c15-10-6-13(19,12(17)18)5-8(11(10)16)7-3-1-2-4-9(7)14(20)21/h1-5,10-11,15-16,19H,6H2,(H,17,18)/t10-,11-,13+/m1/s1 |
| InChIKey | OXKWXALNOCEGBJ-WZRBSPASSA-N |
| XLogP | -0.08 |
| TPSA | 141.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|