C15H13NO7 — CID 52914436
(1R,4R,5R)-1,4,5-trihydroxy-3-[2-(3-nitrophenyl)ethynyl]cyclohex-2-ene-1-carboxylic acid (PubChem CID 52914436) has the molecular formula C15H13NO7 and a molecular weight of 319.27 g/mol. Its IUPAC name is (1R,4R,5R)-1,4,5-trihydroxy-3-[2-(3-nitrophenyl)ethynyl]cyclohex-2-ene-1-carboxylic acid.
| Compound Name | (1R,4R,5R)-1,4,5-trihydroxy-3-[2-(3-nitrophenyl)ethynyl]cyclohex-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 52914436 |
| Molecular Formula | C15H13NO7 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | (1R,4R,5R)-1,4,5-trihydroxy-3-[2-(3-nitrophenyl)ethynyl]cyclohex-2-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@]1(O)C=C(C#Cc2cccc([N+](=O)[O-])c2)[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C15H13NO7/c17-12-8-15(21,14(19)20)7-10(13(12)18)5-4-9-2-1-3-11(6-9)16(22)23/h1-3,6-7,12-13,17-18,21H,8H2,(H,19,20)/t12-,13-,15+/m1/s1 |
| InChIKey | ZQVPJFUQQQCCDH-NFAWXSAZSA-N |
| XLogP | -0.19 |
| TPSA | 141.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|