C16H13F3O5 — CID 52914437
(1R,4R,5R)-1,4,5-trihydroxy-3-[2-[3-(trifluoromethyl)phenyl]ethynyl]cyclohex-2-ene-1-carboxylic acid (PubChem CID 52914437) has the molecular formula C16H13F3O5 and a molecular weight of 342.27 g/mol. Its IUPAC name is (1R,4R,5R)-1,4,5-trihydroxy-3-[2-[3-(trifluoromethyl)phenyl]ethynyl]cyclohex-2-ene-1-carboxylic acid.
| Compound Name | (1R,4R,5R)-1,4,5-trihydroxy-3-[2-[3-(trifluoromethyl)phenyl]ethynyl]cyclohex-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 52914437 |
| Molecular Formula | C16H13F3O5 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | (1R,4R,5R)-1,4,5-trihydroxy-3-[2-[3-(trifluoromethyl)phenyl]ethynyl]cyclohex-2-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@]1(O)C=C(C#Cc2cccc(C(F)(F)F)c2)[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C16H13F3O5/c17-16(18,19)11-3-1-2-9(6-11)4-5-10-7-15(24,14(22)23)8-12(20)13(10)21/h1-3,6-7,12-13,20-21,24H,8H2,(H,22,23)/t12-,13-,15+/m1/s1 |
| InChIKey | IAQFVXAPLPGJED-NFAWXSAZSA-N |
| XLogP | 0.92 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|