About bicyclo[2.1.0]pentane;1-ethynyl-3-(trifluoromethyl)benzene
bicyclo[2.1.0]pentane;1-ethynyl-3-(trifluoromethyl)benzene (PubChem CID 20515239) has the molecular formula C14H13F3
and a molecular weight of 238.25 g/mol. Its IUPAC name is bicyclo[2.1.0]pentane;1-ethynyl-3-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | bicyclo[2.1.0]pentane;1-ethynyl-3-(trifluoromethyl)benzene |
| PubChem CID | 20515239 |
| Molecular Formula | C14H13F3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | bicyclo[2.1.0]pentane;1-ethynyl-3-(trifluoromethyl)benzene |
| SMILES | C#Cc1cccc(C(F)(F)F)c1.C1CC2CC12 |
| InChI | InChI=1S/C9H5F3.C5H8/c1-2-7-4-3-5-8(6-7)9(10,11)12;1-2-5-3-4(1)5/h1,3-6H;4-5H,1-3H2 |
| InChIKey | KLEVLIHWFBSNAS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.1.0]pentane;1-ethynyl-3-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.1.0]pentane;1-ethynyl-3-(trifluoromethyl)benzene?
The IUPAC name of bicyclo[2.1.0]pentane;1-ethynyl-3-(trifluoromethyl)benzene (CID 20515239) is bicyclo[2.1.0]pentane;1-ethynyl-3-(trifluoromethyl)benzene.
What is the SMILES notation for bicyclo[2.1.0]pentane;1-ethynyl-3-(trifluoromethyl)benzene?
The canonical SMILES for bicyclo[2.1.0]pentane;1-ethynyl-3-(trifluoromethyl)benzene is C#Cc1cccc(C(F)(F)F)c1.C1CC2CC12.
What is the InChIKey of bicyclo[2.1.0]pentane;1-ethynyl-3-(trifluoromethyl)benzene?
The InChIKey is KLEVLIHWFBSNAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F3.C5H8/c1-2-7-4-3-5-8(6-7)9(10,11)12;1-2-5-3-4(1)5/h1,3-6H;4-5H,1-3H2.
What are the key properties of bicyclo[2.1.0]pentane;1-ethynyl-3-(trifluoromethyl)benzene?
bicyclo[2.1.0]pentane;1-ethynyl-3-(trifluoromethyl)benzene has a molecular weight of 238.25 g/mol, XLogP of 4.10, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.1.0]pentane;1-ethynyl-3-(trifluoromethyl)benzene is sourced from PubChem (CID 20515239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).