C19H10F6 — CID 14513202
1-ethynyl-3-[2-(3-ethynylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene (PubChem CID 14513202) has the molecular formula C19H10F6 and a molecular weight of 352.28 g/mol. Its IUPAC name is 1-ethynyl-3-[2-(3-ethynylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene.
| Compound Name | 1-ethynyl-3-[2-(3-ethynylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene |
|---|---|
| PubChem CID | 14513202 |
| Molecular Formula | C19H10F6 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 1-ethynyl-3-[2-(3-ethynylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene |
| SMILES | C#Cc1cccc(C(c2cccc(C#C)c2)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C19H10F6/c1-3-13-7-5-9-15(11-13)17(18(20,21)22,19(23,24)25)16-10-6-8-14(4-2)12-16/h1-2,5-12H |
| InChIKey | YJQFTAQKCSDMBY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|