C6H4N3O3+ — CID 174463279
hydron;1,3,5-triazine-2,4,6-tricarbaldehyde (PubChem CID 174463279) has the molecular formula C6H4N3O3+ and a molecular weight of 166.12 g/mol. Its IUPAC name is hydron;1,3,5-triazine-2,4,6-tricarbaldehyde.
| Compound Name | hydron;1,3,5-triazine-2,4,6-tricarbaldehyde |
|---|---|
| PubChem CID | 174463279 |
| Molecular Formula | C6H4N3O3+ |
| Molecular Weight | 166.12 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | hydron;1,3,5-triazine-2,4,6-tricarbaldehyde |
| SMILES | O=Cc1nc(C=O)nc(C=O)n1.[H+] |
| InChI | InChI=1S/C6H3N3O3/c10-1-4-7-5(2-11)9-6(3-12)8-4/h1-3H/p+1 |
| InChIKey | NRVHZCZYBNCGHM-UHFFFAOYSA-O |
| XLogP | -0.58 |
| TPSA | 89.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.12 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|