C6H2Cl2N2O2 — CID 175069673
5,6-dichloropyrimidine-2,4-dicarbaldehyde (PubChem CID 175069673) has the molecular formula C6H2Cl2N2O2 and a molecular weight of 205.00 g/mol. Its IUPAC name is 5,6-dichloropyrimidine-2,4-dicarbaldehyde.
| Compound Name | 5,6-dichloropyrimidine-2,4-dicarbaldehyde |
|---|---|
| PubChem CID | 175069673 |
| Molecular Formula | C6H2Cl2N2O2 |
| Molecular Weight | 205.00 g/mol |
| Exact Mass | 203.95 |
| IUPAC Name | 5,6-dichloropyrimidine-2,4-dicarbaldehyde |
| SMILES | O=Cc1nc(Cl)c(Cl)c(C=O)n1 |
| InChI | InChI=1S/C6H2Cl2N2O2/c7-5-3(1-11)9-4(2-12)10-6(5)8/h1-2H |
| InChIKey | HZQYXSLDQHKCDH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.00 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|