C5H5ClN4O — CID 121478493
3,5-diamino-6-chloropyrazine-2-carbaldehyde (PubChem CID 121478493) has the molecular formula C5H5ClN4O and a molecular weight of 172.58 g/mol. Its IUPAC name is 3,5-diamino-6-chloropyrazine-2-carbaldehyde.
| Compound Name | 3,5-diamino-6-chloropyrazine-2-carbaldehyde |
|---|---|
| PubChem CID | 121478493 |
| Molecular Formula | C5H5ClN4O |
| Molecular Weight | 172.58 g/mol |
| Exact Mass | 172.02 |
| IUPAC Name | 3,5-diamino-6-chloropyrazine-2-carbaldehyde |
| SMILES | Nc1nc(N)c(C=O)nc1Cl |
| InChI | InChI=1S/C5H5ClN4O/c6-3-5(8)10-4(7)2(1-11)9-3/h1H,(H4,7,8,10) |
| InChIKey | LMSCVSJMWDSAQF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.58 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|