C4H3ClN2O2 — CID 83815274
2-amino-4-chloro-1,3-oxazole-5-carbaldehyde (PubChem CID 83815274) has the molecular formula C4H3ClN2O2 and a molecular weight of 146.53 g/mol. Its IUPAC name is 2-amino-4-chloro-1,3-oxazole-5-carbaldehyde.
| Compound Name | 2-amino-4-chloro-1,3-oxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 83815274 |
| Molecular Formula | C4H3ClN2O2 |
| Molecular Weight | 146.53 g/mol |
| Exact Mass | 145.99 |
| IUPAC Name | 2-amino-4-chloro-1,3-oxazole-5-carbaldehyde |
| SMILES | Nc1nc(Cl)c(C=O)o1 |
| InChI | InChI=1S/C4H3ClN2O2/c5-3-2(1-8)9-4(6)7-3/h1H,(H2,6,7) |
| InChIKey | MLTGRBYFCDXLNA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.53 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|