About 2-amino-4-chloro-1,3-oxazole-5-carbaldehyde
2-amino-4-chloro-1,3-oxazole-5-carbaldehyde (PubChem CID 83815274) has the molecular formula C4H3ClN2O2
and a molecular weight of 146.53 g/mol. Its IUPAC name is 2-amino-4-chloro-1,3-oxazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-amino-4-chloro-1,3-oxazole-5-carbaldehyde |
| PubChem CID | 83815274 |
| Molecular Formula | C4H3ClN2O2 |
| Molecular Weight | 146.53 g/mol |
| Exact Mass | 145.99 |
| IUPAC Name | 2-amino-4-chloro-1,3-oxazole-5-carbaldehyde |
| SMILES | Nc1nc(Cl)c(C=O)o1 |
| InChI | InChI=1S/C4H3ClN2O2/c5-3-2(1-8)9-4(6)7-3/h1H,(H2,6,7) |
| InChIKey | MLTGRBYFCDXLNA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.53 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-chloro-1,3-oxazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-chloro-1,3-oxazole-5-carbaldehyde?
The IUPAC name of 2-amino-4-chloro-1,3-oxazole-5-carbaldehyde (CID 83815274) is 2-amino-4-chloro-1,3-oxazole-5-carbaldehyde.
What is the SMILES notation for 2-amino-4-chloro-1,3-oxazole-5-carbaldehyde?
The canonical SMILES for 2-amino-4-chloro-1,3-oxazole-5-carbaldehyde is Nc1nc(Cl)c(C=O)o1.
What is the InChIKey of 2-amino-4-chloro-1,3-oxazole-5-carbaldehyde?
The InChIKey is MLTGRBYFCDXLNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3ClN2O2/c5-3-2(1-8)9-4(6)7-3/h1H,(H2,6,7).
What are the key properties of 2-amino-4-chloro-1,3-oxazole-5-carbaldehyde?
2-amino-4-chloro-1,3-oxazole-5-carbaldehyde has a molecular weight of 146.53 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-chloro-1,3-oxazole-5-carbaldehyde is sourced from PubChem (CID 83815274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).