About 4-amino-3,5,6-trichloropyridine-2-carbaldehyde
4-amino-3,5,6-trichloropyridine-2-carbaldehyde (PubChem CID 86070350) has the molecular formula C6H3Cl3N2O
and a molecular weight of 225.46 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloropyridine-2-carbaldehyde.
Molecular Properties
| Compound Name | 4-amino-3,5,6-trichloropyridine-2-carbaldehyde |
| PubChem CID | 86070350 |
| Molecular Formula | C6H3Cl3N2O |
| Molecular Weight | 225.46 g/mol |
| Exact Mass | 223.93 |
| IUPAC Name | 4-amino-3,5,6-trichloropyridine-2-carbaldehyde |
| SMILES | Nc1c(Cl)c(Cl)nc(C=O)c1Cl |
| InChI | InChI=1S/C6H3Cl3N2O/c7-3-2(1-12)11-6(9)4(8)5(3)10/h1H,(H2,10,11) |
| InChIKey | HAHJTMVXYKLZNN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3,5,6-trichloropyridine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3,5,6-trichloropyridine-2-carbaldehyde?
The IUPAC name of 4-amino-3,5,6-trichloropyridine-2-carbaldehyde (CID 86070350) is 4-amino-3,5,6-trichloropyridine-2-carbaldehyde.
What is the SMILES notation for 4-amino-3,5,6-trichloropyridine-2-carbaldehyde?
The canonical SMILES for 4-amino-3,5,6-trichloropyridine-2-carbaldehyde is Nc1c(Cl)c(Cl)nc(C=O)c1Cl.
What is the InChIKey of 4-amino-3,5,6-trichloropyridine-2-carbaldehyde?
The InChIKey is HAHJTMVXYKLZNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl3N2O/c7-3-2(1-12)11-6(9)4(8)5(3)10/h1H,(H2,10,11).
What are the key properties of 4-amino-3,5,6-trichloropyridine-2-carbaldehyde?
4-amino-3,5,6-trichloropyridine-2-carbaldehyde has a molecular weight of 225.46 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3,5,6-trichloropyridine-2-carbaldehyde is sourced from PubChem (CID 86070350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).