C6H5Cl3N2O2 — CID 169451317
(4-amino-3,5,6-trichloro-2-pyridinyl)methanediol (PubChem CID 169451317) has the molecular formula C6H5Cl3N2O2 and a molecular weight of 243.48 g/mol. Its IUPAC name is (4-amino-3,5,6-trichloro-2-pyridinyl)methanediol.
| Compound Name | (4-amino-3,5,6-trichloro-2-pyridinyl)methanediol |
|---|---|
| PubChem CID | 169451317 |
| Molecular Formula | C6H5Cl3N2O2 |
| Molecular Weight | 243.48 g/mol |
| Exact Mass | 241.94 |
| IUPAC Name | (4-amino-3,5,6-trichloro-2-pyridinyl)methanediol |
| SMILES | Nc1c(Cl)c(Cl)nc(C(O)O)c1Cl |
| InChI | InChI=1S/C6H5Cl3N2O2/c7-1-3(10)2(8)5(9)11-4(1)6(12)13/h6,12-13H,(H2,10,11) |
| InChIKey | BASZUEWJKDUOHR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|