C8H10Cl3N3 — CID 102383001
3,5,6-trichloro-2-N-propylpyridine-2,4-diamine (PubChem CID 102383001) has the molecular formula C8H10Cl3N3 and a molecular weight of 254.55 g/mol. Its IUPAC name is 3,5,6-trichloro-2-N-propylpyridine-2,4-diamine.
| Compound Name | 3,5,6-trichloro-2-N-propylpyridine-2,4-diamine |
|---|---|
| PubChem CID | 102383001 |
| Molecular Formula | C8H10Cl3N3 |
| Molecular Weight | 254.55 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | 3,5,6-trichloro-2-N-propylpyridine-2,4-diamine |
| SMILES | CCCNc1nc(Cl)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C8H10Cl3N3/c1-2-3-13-8-5(10)6(12)4(9)7(11)14-8/h2-3H2,1H3,(H3,12,13,14) |
| InChIKey | NZSYGKCIYFVRLD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|