C9H10ClN3O2 — CID 88854178
6-amino-2-chloro-5-[(Z)-2-ethoxyethenyl]pyrimidine-4-carbaldehyde (PubChem CID 88854178) has the molecular formula C9H10ClN3O2 and a molecular weight of 227.65 g/mol. Its IUPAC name is 6-amino-2-chloro-5-[(Z)-2-ethoxyethenyl]pyrimidine-4-carbaldehyde.
| Compound Name | 6-amino-2-chloro-5-[(Z)-2-ethoxyethenyl]pyrimidine-4-carbaldehyde |
|---|---|
| PubChem CID | 88854178 |
| Molecular Formula | C9H10ClN3O2 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 6-amino-2-chloro-5-[(Z)-2-ethoxyethenyl]pyrimidine-4-carbaldehyde |
| SMILES | CCO/C=C\c1c(N)nc(Cl)nc1C=O |
| InChI | InChI=1S/C9H10ClN3O2/c1-2-15-4-3-6-7(5-14)12-9(10)13-8(6)11/h3-5H,2H2,1H3,(H2,11,12,13)/b4-3- |
| InChIKey | KNSGQKCMWYDJSP-ARJAWSKDSA-N |
| XLogP | 1.53 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|