C12H22N2O2S — CID 174463724
2-ethyl-1-(4-propan-2-ylsulfonylbutyl)imidazole (PubChem CID 174463724) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 2-ethyl-1-(4-propan-2-ylsulfonylbutyl)imidazole.
| Compound Name | 2-ethyl-1-(4-propan-2-ylsulfonylbutyl)imidazole |
|---|---|
| PubChem CID | 174463724 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-ethyl-1-(4-propan-2-ylsulfonylbutyl)imidazole |
| SMILES | CCc1nccn1CCCCS(=O)(=O)C(C)C |
| InChI | InChI=1S/C12H22N2O2S/c1-4-12-13-7-9-14(12)8-5-6-10-17(15,16)11(2)3/h7,9,11H,4-6,8,10H2,1-3H3 |
| InChIKey | CUGFVMKTWFJIAW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|