C9H11N6NaO4 — CID 174464352
sodium 2,4-bis[amino(carbamoyl)amino]benzoate (PubChem CID 174464352) has the molecular formula C9H11N6NaO4 and a molecular weight of 290.22 g/mol. Its IUPAC name is sodium 2,4-bis[amino(carbamoyl)amino]benzoate.
| Compound Name | sodium 2,4-bis[amino(carbamoyl)amino]benzoate |
|---|---|
| PubChem CID | 174464352 |
| Molecular Formula | C9H11N6NaO4 |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | sodium 2,4-bis[amino(carbamoyl)amino]benzoate |
| SMILES | NC(=O)N(N)c1ccc(C(=O)[O-])c(N(N)C(N)=O)c1.[Na+] |
| InChI | InChI=1S/C9H12N6O4.Na/c10-8(18)14(12)4-1-2-5(7(16)17)6(3-4)15(13)9(11)19;/h1-3H,12-13H2,(H2,10,18)(H2,11,19)(H,16,17);/q;+1/p-1 |
| InChIKey | VEUNTVHLJHUZBO-UHFFFAOYSA-M |
| XLogP | -5.43 |
| TPSA | 184.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | -5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|