C16H18N6O2 — CID 174853943
1-amino-1-[4-[2-[4-[amino(carbamoyl)amino]phenyl]ethenyl]phenyl]urea (PubChem CID 174853943) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 1-amino-1-[4-[2-[4-[amino(carbamoyl)amino]phenyl]ethenyl]phenyl]urea.
| Compound Name | 1-amino-1-[4-[2-[4-[amino(carbamoyl)amino]phenyl]ethenyl]phenyl]urea |
|---|---|
| PubChem CID | 174853943 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-amino-1-[4-[2-[4-[amino(carbamoyl)amino]phenyl]ethenyl]phenyl]urea |
| SMILES | NC(=O)N(N)c1ccc(C=Cc2ccc(N(N)C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C16H18N6O2/c17-15(23)21(19)13-7-3-11(4-8-13)1-2-12-5-9-14(10-6-12)22(20)16(18)24/h1-10H,19-20H2,(H2,17,23)(H2,18,24) |
| InChIKey | XTRCDQWYYUUSQX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 144.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|