C18H21N7O5 — CID 89335439
(E)-N-amino-3-[4-[amino-[amino-(3,4-dimethoxyphenyl)carbamoyl]amino]phenyl]-N-nitrosoprop-2-enamide (PubChem CID 89335439) has the molecular formula C18H21N7O5 and a molecular weight of 415.41 g/mol. Its IUPAC name is (E)-N-amino-3-[4-[amino-[amino-(3,4-dimethoxyphenyl)carbamoyl]amino]phenyl]-N-nitrosoprop-2-enamide.
| Compound Name | (E)-N-amino-3-[4-[amino-[amino-(3,4-dimethoxyphenyl)carbamoyl]amino]phenyl]-N-nitrosoprop-2-enamide |
|---|---|
| PubChem CID | 89335439 |
| Molecular Formula | C18H21N7O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (E)-N-amino-3-[4-[amino-[amino-(3,4-dimethoxyphenyl)carbamoyl]amino]phenyl]-N-nitrosoprop-2-enamide |
| SMILES | COc1ccc(N(N)C(=O)N(N)c2ccc(/C=C/C(=O)N(N)N=O)cc2)cc1OC |
| InChI | InChI=1S/C18H21N7O5/c1-29-15-9-8-14(11-16(15)30-2)24(20)18(27)23(19)13-6-3-12(4-7-13)5-10-17(26)25(21)22-28/h3-11H,19-21H2,1-2H3/b10-5+ |
| InChIKey | JAFPULGBLIOHGX-BJMVGYQFSA-N |
| XLogP | 1.28 |
| TPSA | 169.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|