About [2-(2-chloroanilino)-7-fluoro-1,3-benzoxazol-6-yl] 2-(diaminomethylideneamino)acetate
[2-(2-chloroanilino)-7-fluoro-1,3-benzoxazol-6-yl] 2-(diaminomethylideneamino)acetate (PubChem CID 174464419) has the molecular formula C16H13ClFN5O3
and a molecular weight of 377.76 g/mol. Its IUPAC name is [2-(2-chloroanilino)-7-fluoro-1,3-benzoxazol-6-yl] 2-(diaminomethylideneamino)acetate.
Molecular Properties
| Compound Name | [2-(2-chloroanilino)-7-fluoro-1,3-benzoxazol-6-yl] 2-(diaminomethylideneamino)acetate |
| PubChem CID | 174464419 |
| Molecular Formula | C16H13ClFN5O3 |
| Molecular Weight | 377.76 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | [2-(2-chloroanilino)-7-fluoro-1,3-benzoxazol-6-yl] 2-(diaminomethylideneamino)acetate |
| SMILES | NC(N)=NCC(=O)Oc1ccc2nc(Nc3ccccc3Cl)oc2c1F |
| InChI | InChI=1S/C16H13ClFN5O3/c17-8-3-1-2-4-9(8)22-16-23-10-5-6-11(13(18)14(10)26-16)25-12(24)7-21-15(19)20/h1-6H,7H2,(H,22,23)(H4,19,20,21) |
| InChIKey | FUIBYSDIIMJZOU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 128.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.76 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-chloroanilino)-7-fluoro-1,3-benzoxazol-6-yl] 2-(diaminomethylideneamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-chloroanilino)-7-fluoro-1,3-benzoxazol-6-yl] 2-(diaminomethylideneamino)acetate?
The IUPAC name of [2-(2-chloroanilino)-7-fluoro-1,3-benzoxazol-6-yl] 2-(diaminomethylideneamino)acetate (CID 174464419) is [2-(2-chloroanilino)-7-fluoro-1,3-benzoxazol-6-yl] 2-(diaminomethylideneamino)acetate.
What is the SMILES notation for [2-(2-chloroanilino)-7-fluoro-1,3-benzoxazol-6-yl] 2-(diaminomethylideneamino)acetate?
The canonical SMILES for [2-(2-chloroanilino)-7-fluoro-1,3-benzoxazol-6-yl] 2-(diaminomethylideneamino)acetate is NC(N)=NCC(=O)Oc1ccc2nc(Nc3ccccc3Cl)oc2c1F.
What is the InChIKey of [2-(2-chloroanilino)-7-fluoro-1,3-benzoxazol-6-yl] 2-(diaminomethylideneamino)acetate?
The InChIKey is FUIBYSDIIMJZOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClFN5O3/c17-8-3-1-2-4-9(8)22-16-23-10-5-6-11(13(18)14(10)26-16)25-12(24)7-21-15(19)20/h1-6H,7H2,(H,22,23)(H4,19,20,21).
What are the key properties of [2-(2-chloroanilino)-7-fluoro-1,3-benzoxazol-6-yl] 2-(diaminomethylideneamino)acetate?
[2-(2-chloroanilino)-7-fluoro-1,3-benzoxazol-6-yl] 2-(diaminomethylideneamino)acetate has a molecular weight of 377.76 g/mol, XLogP of 2.54, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-chloroanilino)-7-fluoro-1,3-benzoxazol-6-yl] 2-(diaminomethylideneamino)acetate is sourced from PubChem (CID 174464419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).