About 1-iodo-4-propan-2-ylbenzene;trifluoromethylbenzene
1-iodo-4-propan-2-ylbenzene;trifluoromethylbenzene (PubChem CID 174465530) has the molecular formula C16H16F3I
and a molecular weight of 392.20 g/mol. Its IUPAC name is 1-iodo-4-propan-2-ylbenzene;trifluoromethylbenzene.
Molecular Properties
| Compound Name | 1-iodo-4-propan-2-ylbenzene;trifluoromethylbenzene |
| PubChem CID | 174465530 |
| Molecular Formula | C16H16F3I |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 1-iodo-4-propan-2-ylbenzene;trifluoromethylbenzene |
| SMILES | CC(C)c1ccc(I)cc1.FC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C9H11I.C7H5F3/c1-7(2)8-3-5-9(10)6-4-8;8-7(9,10)6-4-2-1-3-5-6/h3-7H,1-2H3;1-5H |
| InChIKey | ZSCMGKCZVNQYCN-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-4-propan-2-ylbenzene;trifluoromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-4-propan-2-ylbenzene;trifluoromethylbenzene?
The IUPAC name of 1-iodo-4-propan-2-ylbenzene;trifluoromethylbenzene (CID 174465530) is 1-iodo-4-propan-2-ylbenzene;trifluoromethylbenzene.
What is the SMILES notation for 1-iodo-4-propan-2-ylbenzene;trifluoromethylbenzene?
The canonical SMILES for 1-iodo-4-propan-2-ylbenzene;trifluoromethylbenzene is CC(C)c1ccc(I)cc1.FC(F)(F)c1ccccc1.
What is the InChIKey of 1-iodo-4-propan-2-ylbenzene;trifluoromethylbenzene?
The InChIKey is ZSCMGKCZVNQYCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11I.C7H5F3/c1-7(2)8-3-5-9(10)6-4-8;8-7(9,10)6-4-2-1-3-5-6/h3-7H,1-2H3;1-5H.
What are the key properties of 1-iodo-4-propan-2-ylbenzene;trifluoromethylbenzene?
1-iodo-4-propan-2-ylbenzene;trifluoromethylbenzene has a molecular weight of 392.20 g/mol, XLogP of 6.12, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-4-propan-2-ylbenzene;trifluoromethylbenzene is sourced from PubChem (CID 174465530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).