C11H21FN4 — CID 174466029
N,N-dimethylmethanamine;2-[2-(3-fluorophenyl)hydrazinyl]ethanamine (PubChem CID 174466029) has the molecular formula C11H21FN4 and a molecular weight of 228.32 g/mol. Its IUPAC name is N,N-dimethylmethanamine;2-[2-(3-fluorophenyl)hydrazinyl]ethanamine.
| Compound Name | N,N-dimethylmethanamine;2-[2-(3-fluorophenyl)hydrazinyl]ethanamine |
|---|---|
| PubChem CID | 174466029 |
| Molecular Formula | C11H21FN4 |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N,N-dimethylmethanamine;2-[2-(3-fluorophenyl)hydrazinyl]ethanamine |
| SMILES | CN(C)C.NCCNNc1cccc(F)c1 |
| InChI | InChI=1S/C8H12FN3.C3H9N/c9-7-2-1-3-8(6-7)12-11-5-4-10;1-4(2)3/h1-3,6,11-12H,4-5,10H2;1-3H3 |
| InChIKey | BMWNBFPPJFGTGI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|