C14H23FN4 — CID 110032256
2-[3-(3-fluoroanilino)propyl]-1,1,3,3-tetramethylguanidine (PubChem CID 110032256) has the molecular formula C14H23FN4 and a molecular weight of 266.36 g/mol. Its IUPAC name is 2-[3-(3-fluoroanilino)propyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[3-(3-fluoroanilino)propyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 110032256 |
| Molecular Formula | C14H23FN4 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2-[3-(3-fluoroanilino)propyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=NCCCNc1cccc(F)c1)N(C)C |
| InChI | InChI=1S/C14H23FN4/c1-18(2)14(19(3)4)17-10-6-9-16-13-8-5-7-12(15)11-13/h5,7-8,11,16H,6,9-10H2,1-4H3 |
| InChIKey | UHHROOLPAWKFCM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|