C20H28FNO4S — CID 174466609
tert-butyl 4-[1-(2-fluorophenyl)prop-2-enylsulfonylmethyl]piperidine-1-carboxylate (PubChem CID 174466609) has the molecular formula C20H28FNO4S and a molecular weight of 397.51 g/mol. Its IUPAC name is tert-butyl 4-[1-(2-fluorophenyl)prop-2-enylsulfonylmethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(2-fluorophenyl)prop-2-enylsulfonylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174466609 |
| Molecular Formula | C20H28FNO4S |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | tert-butyl 4-[1-(2-fluorophenyl)prop-2-enylsulfonylmethyl]piperidine-1-carboxylate |
| SMILES | C=CC(c1ccccc1F)S(=O)(=O)CC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H28FNO4S/c1-5-18(16-8-6-7-9-17(16)21)27(24,25)14-15-10-12-22(13-11-15)19(23)26-20(2,3)4/h5-9,15,18H,1,10-14H2,2-4H3 |
| InChIKey | JUIMMAYLYMKPGA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|