C24H31N3O9S — CID 174467563
1-ethyl-5-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-(4-morpholin-4-ylphenyl)-4-oxoimidazolidine-2-sulfonic acid (PubChem CID 174467563) has the molecular formula C24H31N3O9S and a molecular weight of 537.59 g/mol. Its IUPAC name is 1-ethyl-5-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-(4-morpholin-4-ylphenyl)-4-oxoimidazolidine-2-sulfonic acid.
| Compound Name | 1-ethyl-5-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-(4-morpholin-4-ylphenyl)-4-oxoimidazolidine-2-sulfonic acid |
|---|---|
| PubChem CID | 174467563 |
| Molecular Formula | C24H31N3O9S |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | 1-ethyl-5-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-(4-morpholin-4-ylphenyl)-4-oxoimidazolidine-2-sulfonic acid |
| SMILES | CCC1(C(=O)O)C=C(C)C=C(C(=O)O)C1.O=C1CN(c2ccc(N3CCOCC3)cc2)C(S(=O)(=O)O)N1 |
| InChI | InChI=1S/C13H17N3O5S.C11H14O4/c17-12-9-16(13(14-12)22(18,19)20)11-3-1-10(2-4-11)15-5-7-21-8-6-15;1-3-11(10(14)15)5-7(2)4-8(6-11)9(12)13/h1-4,13H,5-9H2,(H,14,17)(H,18,19,20);4-5H,3,6H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | VAAPAPNDGYYVKQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 173.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|