C26H27N3O9S2 — CID 174455182
5-methylbenzene-1,3-dicarboxylic acid;1-(4-morpholin-4-ylphenyl)-4-oxo-3-thiophen-2-ylimidazolidine-2-sulfonic acid (PubChem CID 174455182) has the molecular formula C26H27N3O9S2 and a molecular weight of 589.65 g/mol. Its IUPAC name is 5-methylbenzene-1,3-dicarboxylic acid;1-(4-morpholin-4-ylphenyl)-4-oxo-3-thiophen-2-ylimidazolidine-2-sulfonic acid.
| Compound Name | 5-methylbenzene-1,3-dicarboxylic acid;1-(4-morpholin-4-ylphenyl)-4-oxo-3-thiophen-2-ylimidazolidine-2-sulfonic acid |
|---|---|
| PubChem CID | 174455182 |
| Molecular Formula | C26H27N3O9S2 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.12 |
| IUPAC Name | 5-methylbenzene-1,3-dicarboxylic acid;1-(4-morpholin-4-ylphenyl)-4-oxo-3-thiophen-2-ylimidazolidine-2-sulfonic acid |
| SMILES | Cc1cc(C(=O)O)cc(C(=O)O)c1.O=C1CN(c2ccc(N3CCOCC3)cc2)C(S(=O)(=O)O)N1c1cccs1 |
| InChI | InChI=1S/C17H19N3O5S2.C9H8O4/c21-15-12-19(17(27(22,23)24)20(15)16-2-1-11-26-16)14-5-3-13(4-6-14)18-7-9-25-10-8-18;1-5-2-6(8(10)11)4-7(3-5)9(12)13/h1-6,11,17H,7-10,12H2,(H,22,23,24);2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | JSANVGLGWNOVFI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 164.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|