C16H21N3O5S — CID 174455196
1-(4-morpholin-4-ylphenyl)-4-oxo-3-prop-2-enylimidazolidine-2-sulfonic acid (PubChem CID 174455196) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is 1-(4-morpholin-4-ylphenyl)-4-oxo-3-prop-2-enylimidazolidine-2-sulfonic acid.
| Compound Name | 1-(4-morpholin-4-ylphenyl)-4-oxo-3-prop-2-enylimidazolidine-2-sulfonic acid |
|---|---|
| PubChem CID | 174455196 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 1-(4-morpholin-4-ylphenyl)-4-oxo-3-prop-2-enylimidazolidine-2-sulfonic acid |
| SMILES | C=CCN1C(=O)CN(c2ccc(N3CCOCC3)cc2)C1S(=O)(=O)O |
| InChI | InChI=1S/C16H21N3O5S/c1-2-7-18-15(20)12-19(16(18)25(21,22)23)14-5-3-13(4-6-14)17-8-10-24-11-9-17/h2-6,16H,1,7-12H2,(H,21,22,23) |
| InChIKey | LCHCVUALTJSTOE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|