C13H19N3O6S — CID 174467976
ethyl 2-[[2-(benzenesulfonamido)-2-nitroethyl]amino]propanoate (PubChem CID 174467976) has the molecular formula C13H19N3O6S and a molecular weight of 345.38 g/mol. Its IUPAC name is ethyl 2-[[2-(benzenesulfonamido)-2-nitroethyl]amino]propanoate.
| Compound Name | ethyl 2-[[2-(benzenesulfonamido)-2-nitroethyl]amino]propanoate |
|---|---|
| PubChem CID | 174467976 |
| Molecular Formula | C13H19N3O6S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | ethyl 2-[[2-(benzenesulfonamido)-2-nitroethyl]amino]propanoate |
| SMILES | CCOC(=O)C(C)NCC(NS(=O)(=O)c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N3O6S/c1-3-22-13(17)10(2)14-9-12(16(18)19)15-23(20,21)11-7-5-4-6-8-11/h4-8,10,12,14-15H,3,9H2,1-2H3 |
| InChIKey | VVAWAYZLIMKAOX-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|