C22H36N4O17 — CID 174475387
9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;2,3,4,5,6-pentahydroxyhexanal;1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 174475387) has the molecular formula C22H36N4O17 and a molecular weight of 628.54 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;2,3,4,5,6-pentahydroxyhexanal;1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;2,3,4,5,6-pentahydroxyhexanal;1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 174475387 |
| Molecular Formula | C22H36N4O17 |
| Molecular Weight | 628.54 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;2,3,4,5,6-pentahydroxyhexanal;1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | O=C(CO)C(O)C(O)C(O)CO.O=CC(O)C(O)C(O)C(O)CO.O=c1[nH]cnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H12N4O5.2C6H12O6/c15-1-4-6(16)7(17)10(19-4)14-3-13-5-8(14)11-2-12-9(5)18;2*7-1-3(9)5(11)6(12)4(10)2-8/h2-4,6-7,10,15-17H,1H2,(H,11,12,18);3,5-9,11-12H,1-2H2;1,3-6,8-12H,2H2/t4-,6-,7-,10-;;/m1../s1 |
| InChIKey | JSDLFKQNKAMARH-IDIVVRGQSA-N |
| XLogP | -9.02 |
| TPSA | 369.93 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.54 |
| LogP ≤ 5 | -9.02 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|