C20H19ClN2O2 — CID 174475581
N-chloro-N-[3-[3-(2-propan-2-ylphenyl)-1,2-oxazol-5-yl]phenyl]acetamide (PubChem CID 174475581) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is N-chloro-N-[3-[3-(2-propan-2-ylphenyl)-1,2-oxazol-5-yl]phenyl]acetamide.
| Compound Name | N-chloro-N-[3-[3-(2-propan-2-ylphenyl)-1,2-oxazol-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 174475581 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-chloro-N-[3-[3-(2-propan-2-ylphenyl)-1,2-oxazol-5-yl]phenyl]acetamide |
| SMILES | CC(=O)N(Cl)c1cccc(-c2cc(-c3ccccc3C(C)C)no2)c1 |
| InChI | InChI=1S/C20H19ClN2O2/c1-13(2)17-9-4-5-10-18(17)19-12-20(25-22-19)15-7-6-8-16(11-15)23(21)14(3)24/h4-13H,1-3H3 |
| InChIKey | MQRKVISIQZUMQQ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|