C16H18O3 — CID 174478844
2-[2-(3-methylbutanoyl)-2,3-dihydro-1H-inden-1-yl]-2-oxoacetaldehyde (PubChem CID 174478844) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[2-(3-methylbutanoyl)-2,3-dihydro-1H-inden-1-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[2-(3-methylbutanoyl)-2,3-dihydro-1H-inden-1-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 174478844 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2-[2-(3-methylbutanoyl)-2,3-dihydro-1H-inden-1-yl]-2-oxoacetaldehyde |
| SMILES | CC(C)CC(=O)C1Cc2ccccc2C1C(=O)C=O |
| InChI | InChI=1S/C16H18O3/c1-10(2)7-14(18)13-8-11-5-3-4-6-12(11)16(13)15(19)9-17/h3-6,9-10,13,16H,7-8H2,1-2H3 |
| InChIKey | MSAHVNOWWHSUGF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|